C17H18FN3O3 — CID 68852249
(3R)-1'-(cyclohexylmethyl)-5-fluorospiro[1H-indole-3,5'-imidazolidine]-2,2',4'-trione (PubChem CID 68852249) has the molecular formula C17H18FN3O3 and a molecular weight of 331.35 g/mol. Its IUPAC name is (3R)-1'-(cyclohexylmethyl)-5-fluorospiro[1H-indole-3,5'-imidazolidine]-2,2',4'-trione.
| Compound Name | (3R)-1'-(cyclohexylmethyl)-5-fluorospiro[1H-indole-3,5'-imidazolidine]-2,2',4'-trione |
|---|---|
| PubChem CID | 68852249 |
| Molecular Formula | C17H18FN3O3 |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | (3R)-1'-(cyclohexylmethyl)-5-fluorospiro[1H-indole-3,5'-imidazolidine]-2,2',4'-trione |
| SMILES | O=C1NC(=O)[C@@]2(C(=O)Nc3ccc(F)cc32)N1CC1CCCCC1 |
| InChI | InChI=1S/C17H18FN3O3/c18-11-6-7-13-12(8-11)17(14(22)19-13)15(23)20-16(24)21(17)9-10-4-2-1-3-5-10/h6-8,10H,1-5,9H2,(H,19,22)(H,20,23,24)/t17-/m1/s1 |
| InChIKey | CGJANKBDZFHUFC-QGZVFWFLSA-N |
| XLogP | 2.11 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|