About diethylcarbamic acid;N-ethylethanamine
diethylcarbamic acid;N-ethylethanamine (PubChem CID 14597070) has the molecular formula C9H22N2O2
and a molecular weight of 190.29 g/mol. Its IUPAC name is diethylcarbamic acid;N-ethylethanamine.
Molecular Properties
| Compound Name | diethylcarbamic acid;N-ethylethanamine |
| PubChem CID | 14597070 |
| Molecular Formula | C9H22N2O2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | diethylcarbamic acid;N-ethylethanamine |
| SMILES | CCN(CC)C(=O)O.CCNCC |
| InChI | InChI=1S/C5H11NO2.C4H11N/c1-3-6(4-2)5(7)8;1-3-5-4-2/h3-4H2,1-2H3,(H,7,8);5H,3-4H2,1-2H3 |
| InChIKey | VPMRKXZSCHVIJE-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze diethylcarbamic acid;N-ethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethylcarbamic acid;N-ethylethanamine?
The IUPAC name of diethylcarbamic acid;N-ethylethanamine (CID 14597070) is diethylcarbamic acid;N-ethylethanamine.
What is the SMILES notation for diethylcarbamic acid;N-ethylethanamine?
The canonical SMILES for diethylcarbamic acid;N-ethylethanamine is CCN(CC)C(=O)O.CCNCC.
What is the InChIKey of diethylcarbamic acid;N-ethylethanamine?
The InChIKey is VPMRKXZSCHVIJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO2.C4H11N/c1-3-6(4-2)5(7)8;1-3-5-4-2/h3-4H2,1-2H3,(H,7,8);5H,3-4H2,1-2H3.
What are the key properties of diethylcarbamic acid;N-ethylethanamine?
diethylcarbamic acid;N-ethylethanamine has a molecular weight of 190.29 g/mol, XLogP of 1.62, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diethylcarbamic acid;N-ethylethanamine is sourced from PubChem (CID 14597070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).