C17H15ClN4OS2 — CID 146000944
1-(4-chlorophenyl)-3-[4-(4-methoxyphenyl)-2-sulfanylidene-1H-imidazol-3-yl]thiourea (PubChem CID 146000944) has the molecular formula C17H15ClN4OS2 and a molecular weight of 390.92 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[4-(4-methoxyphenyl)-2-sulfanylidene-1H-imidazol-3-yl]thiourea.
| Compound Name | 1-(4-chlorophenyl)-3-[4-(4-methoxyphenyl)-2-sulfanylidene-1H-imidazol-3-yl]thiourea |
|---|---|
| PubChem CID | 146000944 |
| Molecular Formula | C17H15ClN4OS2 |
| Molecular Weight | 390.92 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[4-(4-methoxyphenyl)-2-sulfanylidene-1H-imidazol-3-yl]thiourea |
| SMILES | COc1ccc(-c2c[nH]c(=S)n2NC(=S)Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C17H15ClN4OS2/c1-23-14-8-2-11(3-9-14)15-10-19-17(25)22(15)21-16(24)20-13-6-4-12(18)5-7-13/h2-10H,1H3,(H,19,25)(H2,20,21,24) |
| InChIKey | UTXOJASAJHIPLV-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 54.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.92 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|