C8H3BrF6Zn — CID 146001685
1,4-bis(trifluoromethyl)benzene-6-ide;bromozinc(1+) (PubChem CID 146001685) has the molecular formula C8H3BrF6Zn and a molecular weight of 358.39 g/mol. Its IUPAC name is 1,4-bis(trifluoromethyl)benzene-6-ide;bromozinc(1+).
| Compound Name | 1,4-bis(trifluoromethyl)benzene-6-ide;bromozinc(1+) |
|---|---|
| PubChem CID | 146001685 |
| Molecular Formula | C8H3BrF6Zn |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 355.86 |
| IUPAC Name | 1,4-bis(trifluoromethyl)benzene-6-ide;bromozinc(1+) |
| SMILES | FC(F)(F)c1[c-]cc(C(F)(F)F)cc1.[Zn+]Br |
| InChI | InChI=1S/C8H3F6.BrH.Zn/c9-7(10,11)5-1-2-6(4-3-5)8(12,13)14;;/h1-3H;1H;/q-1;;+2/p-1 |
| InChIKey | BWRLYJOLWNMTFU-UHFFFAOYSA-M |
| XLogP | 4.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|