About 1-chloro-4-(trifluoromethyl)benzene-6-ide;iodomanganese(1+)
1-chloro-4-(trifluoromethyl)benzene-6-ide;iodomanganese(1+) (PubChem CID 169034021) has the molecular formula C7H3ClF3IMn
and a molecular weight of 361.39 g/mol. Its IUPAC name is 1-chloro-4-(trifluoromethyl)benzene-6-ide;iodomanganese(1+).
Molecular Properties
| Compound Name | 1-chloro-4-(trifluoromethyl)benzene-6-ide;iodomanganese(1+) |
| PubChem CID | 169034021 |
| Molecular Formula | C7H3ClF3IMn |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 360.83 |
| IUPAC Name | 1-chloro-4-(trifluoromethyl)benzene-6-ide;iodomanganese(1+) |
| SMILES | FC(F)(F)c1c[c-]c(Cl)cc1.[Mn+]I |
| InChI | InChI=1S/C7H3ClF3.HI.Mn/c8-6-3-1-5(2-4-6)7(9,10)11;;/h1-3H;1H;/q-1;;+2/p-1 |
| InChIKey | FOYIGTLBHPMOIM-UHFFFAOYSA-M |
| XLogP | 4.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-4-(trifluoromethyl)benzene-6-ide;iodomanganese(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-(trifluoromethyl)benzene-6-ide;iodomanganese(1+)?
The IUPAC name of 1-chloro-4-(trifluoromethyl)benzene-6-ide;iodomanganese(1+) (CID 169034021) is 1-chloro-4-(trifluoromethyl)benzene-6-ide;iodomanganese(1+).
What is the SMILES notation for 1-chloro-4-(trifluoromethyl)benzene-6-ide;iodomanganese(1+)?
The canonical SMILES for 1-chloro-4-(trifluoromethyl)benzene-6-ide;iodomanganese(1+) is FC(F)(F)c1c[c-]c(Cl)cc1.[Mn+]I.
What is the InChIKey of 1-chloro-4-(trifluoromethyl)benzene-6-ide;iodomanganese(1+)?
The InChIKey is FOYIGTLBHPMOIM-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H3ClF3.HI.Mn/c8-6-3-1-5(2-4-6)7(9,10)11;;/h1-3H;1H;/q-1;;+2/p-1.
What are the key properties of 1-chloro-4-(trifluoromethyl)benzene-6-ide;iodomanganese(1+)?
1-chloro-4-(trifluoromethyl)benzene-6-ide;iodomanganese(1+) has a molecular weight of 361.39 g/mol, XLogP of 4.04, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-(trifluoromethyl)benzene-6-ide;iodomanganese(1+) is sourced from PubChem (CID 169034021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).