C9H2BrF9Mg — CID 15865245
magnesium;1,3,5-tris(trifluoromethyl)benzene-6-ide;bromide (PubChem CID 15865245) has the molecular formula C9H2BrF9Mg and a molecular weight of 385.31 g/mol. Its IUPAC name is magnesium;1,3,5-tris(trifluoromethyl)benzene-6-ide;bromide.
| Compound Name | magnesium;1,3,5-tris(trifluoromethyl)benzene-6-ide;bromide |
|---|---|
| PubChem CID | 15865245 |
| Molecular Formula | C9H2BrF9Mg |
| Molecular Weight | 385.31 g/mol |
| Exact Mass | 383.90 |
| IUPAC Name | magnesium;1,3,5-tris(trifluoromethyl)benzene-6-ide;bromide |
| SMILES | FC(F)(F)c1[c-]c(C(F)(F)F)cc(C(F)(F)F)c1.[Br-].[Mg+2] |
| InChI | InChI=1S/C9H2F9.BrH.Mg/c10-7(11,12)4-1-5(8(13,14)15)3-6(2-4)9(16,17)18;;/h1-2H;1H;/q-1;;+2/p-1 |
| InChIKey | PAPSNHVMARINRX-UHFFFAOYSA-M |
| XLogP | 1.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.31 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|