C14H18O — CID 146003314
1-(3,5-dimethylphenyl)-4-methylpent-1-yn-3-ol (PubChem CID 146003314) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-4-methylpent-1-yn-3-ol.
| Compound Name | 1-(3,5-dimethylphenyl)-4-methylpent-1-yn-3-ol |
|---|---|
| PubChem CID | 146003314 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-4-methylpent-1-yn-3-ol |
| SMILES | Cc1cc(C)cc(C#CC(O)C(C)C)c1 |
| InChI | InChI=1S/C14H18O/c1-10(2)14(15)6-5-13-8-11(3)7-12(4)9-13/h7-10,14-15H,1-4H3 |
| InChIKey | NVUMVSQJBBIHRL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|