C42H56O4S4 — CID 146012639
CID 146012639 (PubChem CID 146012639) has the molecular formula C42H56O4S4 and a molecular weight of 753.17 g/mol.
| Compound Name | CID 146012639 |
|---|---|
| PubChem CID | 146012639 |
| Molecular Formula | C42H56O4S4 |
| Molecular Weight | 753.17 g/mol |
| Exact Mass | 752.31 |
| IUPAC Name | — |
| SMILES | CCCCCCC(CCCC)COC(=O)c1c[c]sc1-c1ccc(-c2ccc(-c3s[c]cc3C(=O)OCC(CCCC)CCCCCC)s2)s1 |
| InChI | InChI=1S/C42H56O4S4/c1-5-9-13-15-19-31(17-11-7-3)29-45-41(43)33-25-27-47-39(33)37-23-21-35(49-37)36-22-24-38(50-36)40-34(26-28-48-40)42(44)46-30-32(18-12-8-4)20-16-14-10-6-2/h21-26,31-32H,5-20,29-30H2,1-4H3 |
| InChIKey | WZMUYZASTRRKIK-UHFFFAOYSA-N |
| XLogP | 14.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.17 |
| LogP ≤ 5 | 14.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|