C34H52Br2O4S2 — CID 67042476
2-butyloctyl 2-bromo-5-[5-bromo-4-(2-butyloctoxycarbonyl)thiophen-2-yl]thiophene-3-carboxylate (PubChem CID 67042476) has the molecular formula C34H52Br2O4S2 and a molecular weight of 748.73 g/mol. Its IUPAC name is 2-butyloctyl 2-bromo-5-[5-bromo-4-(2-butyloctoxycarbonyl)thiophen-2-yl]thiophene-3-carboxylate.
| Compound Name | 2-butyloctyl 2-bromo-5-[5-bromo-4-(2-butyloctoxycarbonyl)thiophen-2-yl]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 67042476 |
| Molecular Formula | C34H52Br2O4S2 |
| Molecular Weight | 748.73 g/mol |
| Exact Mass | 746.17 |
| IUPAC Name | 2-butyloctyl 2-bromo-5-[5-bromo-4-(2-butyloctoxycarbonyl)thiophen-2-yl]thiophene-3-carboxylate |
| SMILES | CCCCCCC(CCCC)COC(=O)c1cc(-c2cc(C(=O)OCC(CCCC)CCCCCC)c(Br)s2)sc1Br |
| InChI | InChI=1S/C34H52Br2O4S2/c1-5-9-13-15-19-25(17-11-7-3)23-39-33(37)27-21-29(41-31(27)35)30-22-28(32(36)42-30)34(38)40-24-26(18-12-8-4)20-16-14-10-6-2/h21-22,25-26H,5-20,23-24H2,1-4H3 |
| InChIKey | IMXQNKUGFLUHTP-UHFFFAOYSA-N |
| XLogP | 12.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.73 |
| LogP ≤ 5 | 12.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|