C34H40F2S6 — CID 146013143
4,8-bis[5-(2-ethylhexylsulfanyl)-4-fluorothiophen-2-yl]thieno[2,3-f][1]benzothiole (PubChem CID 146013143) has the molecular formula C34H40F2S6 and a molecular weight of 679.09 g/mol. Its IUPAC name is 4,8-bis[5-(2-ethylhexylsulfanyl)-4-fluorothiophen-2-yl]thieno[2,3-f][1]benzothiole.
| Compound Name | 4,8-bis[5-(2-ethylhexylsulfanyl)-4-fluorothiophen-2-yl]thieno[2,3-f][1]benzothiole |
|---|---|
| PubChem CID | 146013143 |
| Molecular Formula | C34H40F2S6 |
| Molecular Weight | 679.09 g/mol |
| Exact Mass | 678.14 |
| IUPAC Name | 4,8-bis[5-(2-ethylhexylsulfanyl)-4-fluorothiophen-2-yl]thieno[2,3-f][1]benzothiole |
| SMILES | CCCCC(CC)CSc1sc(-c2c3ccsc3c(-c3cc(F)c(SCC(CC)CCCC)s3)c3ccsc23)cc1F |
| InChI | InChI=1S/C34H40F2S6/c1-5-9-11-21(7-3)19-39-33-25(35)17-27(41-33)29-23-13-15-38-32(23)30(24-14-16-37-31(24)29)28-18-26(36)34(42-28)40-20-22(8-4)12-10-6-2/h13-18,21-22H,5-12,19-20H2,1-4H3 |
| InChIKey | YWDLQNULVDNQJV-UHFFFAOYSA-N |
| XLogP | 14.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.09 |
| LogP ≤ 5 | 14.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |