C16H21NO8 — CID 146014921
(2S,3S,4S,5R,6R)-6-[2-amino-3-(4-methylphenyl)-3-oxopropoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 146014921) has the molecular formula C16H21NO8 and a molecular weight of 355.34 g/mol. Its IUPAC name is (2S,3S,4S,5R,6R)-6-[2-amino-3-(4-methylphenyl)-3-oxopropoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R,6R)-6-[2-amino-3-(4-methylphenyl)-3-oxopropoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 146014921 |
| Molecular Formula | C16H21NO8 |
| Molecular Weight | 355.34 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | (2S,3S,4S,5R,6R)-6-[2-amino-3-(4-methylphenyl)-3-oxopropoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | Cc1ccc(C(=O)C(N)CO[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C16H21NO8/c1-7-2-4-8(5-3-7)10(18)9(17)6-24-16-13(21)11(19)12(20)14(25-16)15(22)23/h2-5,9,11-14,16,19-21H,6,17H2,1H3,(H,22,23)/t9?,11-,12-,13+,14-,16+/m0/s1 |
| InChIKey | LCLSUHHWDCKFPJ-QGXMKYLMSA-N |
| XLogP | -1.59 |
| TPSA | 159.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.34 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |