C15H19ClO9 — CID 171394535
(2S,3S,4S,5R,6R)-6-[3-(4-chlorophenoxy)-2-hydroxypropoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 171394535) has the molecular formula C15H19ClO9 and a molecular weight of 378.76 g/mol. Its IUPAC name is (2S,3S,4S,5R,6R)-6-[3-(4-chlorophenoxy)-2-hydroxypropoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R,6R)-6-[3-(4-chlorophenoxy)-2-hydroxypropoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 171394535 |
| Molecular Formula | C15H19ClO9 |
| Molecular Weight | 378.76 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | (2S,3S,4S,5R,6R)-6-[3-(4-chlorophenoxy)-2-hydroxypropoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1O[C@@H](OCC(O)COc2ccc(Cl)cc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H19ClO9/c16-7-1-3-9(4-2-7)23-5-8(17)6-24-15-12(20)10(18)11(19)13(25-15)14(21)22/h1-4,8,10-13,15,17-20H,5-6H2,(H,21,22)/t8?,10-,11-,12+,13-,15+/m0/s1 |
| InChIKey | LGVZKEDZKVAXHY-AEIUROHVSA-N |
| XLogP | -1.01 |
| TPSA | 145.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.76 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |