C18H9N4O14PS2 — CID 146015363
3-[[4-formyl-6-methyl-5-oxonio-3-(phosphonatooxymethyl)-2-pyridinyl]diazenyl]-7-nitro-4,6-dihydro-2H-naphthalene-2,4,6-triylium-1,5-disulfonate (PubChem CID 146015363) has the molecular formula C18H9N4O14PS2 and a molecular weight of 600.39 g/mol. Its IUPAC name is 3-[[4-formyl-6-methyl-5-oxonio-3-(phosphonatooxymethyl)-2-pyridinyl]diazenyl]-7-nitro-4,6-dihydro-2H-naphthalene-2,4,6-triylium-1,5-disulfonate.
| Compound Name | 3-[[4-formyl-6-methyl-5-oxonio-3-(phosphonatooxymethyl)-2-pyridinyl]diazenyl]-7-nitro-4,6-dihydro-2H-naphthalene-2,4,6-triylium-1,5-disulfonate |
|---|---|
| PubChem CID | 146015363 |
| Molecular Formula | C18H9N4O14PS2 |
| Molecular Weight | 600.39 g/mol |
| Exact Mass | 599.93 |
| IUPAC Name | 3-[[4-formyl-6-methyl-5-oxonio-3-(phosphonatooxymethyl)-2-pyridinyl]diazenyl]-7-nitro-4,6-dihydro-2H-naphthalene-2,4,6-triylium-1,5-disulfonate |
| SMILES | Cc1nc(/N=N/C2=[C+]C3=C(C=C([N+](=O)[O-])[C+]=C3S(=O)(=O)[O-])C(S(=O)(=O)[O-])=[C+]2)c(COP(=O)([O-])[O-])c(C=O)c1[OH2+] |
| InChI | InChI=1S/C18H9N4O14PS2/c1-8-17(24)13(6-23)14(7-36-37(27,28)29)18(19-8)21-20-9-2-11-12(15(3-9)38(30,31)32)4-10(22(25)26)5-16(11)39(33,34)35/h4,6H,7H2,1H3,(H2-3,20,23,24,27,28,29,30,31,32,33,34,35) |
| InChIKey | IQLUCDWRFTVZGU-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 307.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.39 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|