C14H11ClN4NaO8P — CID 172875053
sodium [2-[(2-chloro-5-nitrophenyl)diazenyl]-4-formyl-5-hydroxy-6-methyl-3-pyridinyl]methyl hydrogen phosphate (PubChem CID 172875053) has the molecular formula C14H11ClN4NaO8P and a molecular weight of 452.68 g/mol. Its IUPAC name is sodium [2-[(2-chloro-5-nitrophenyl)diazenyl]-4-formyl-5-hydroxy-6-methyl-3-pyridinyl]methyl hydrogen phosphate.
| Compound Name | sodium [2-[(2-chloro-5-nitrophenyl)diazenyl]-4-formyl-5-hydroxy-6-methyl-3-pyridinyl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 172875053 |
| Molecular Formula | C14H11ClN4NaO8P |
| Molecular Weight | 452.68 g/mol |
| Exact Mass | 451.99 |
| IUPAC Name | sodium [2-[(2-chloro-5-nitrophenyl)diazenyl]-4-formyl-5-hydroxy-6-methyl-3-pyridinyl]methyl hydrogen phosphate |
| SMILES | Cc1nc(/N=N/c2cc([N+](=O)[O-])ccc2Cl)c(COP(=O)([O-])O)c(C=O)c1O.[Na+] |
| InChI | InChI=1S/C14H12ClN4O8P.Na/c1-7-13(21)9(5-20)10(6-27-28(24,25)26)14(16-7)18-17-12-4-8(19(22)23)2-3-11(12)15;/h2-5,21H,6H2,1H3,(H2,24,25,26);/q;+1/p-1/b18-17+; |
| InChIKey | IBWOMJSXJPAEPE-ZAGWXBKKSA-M |
| XLogP | -0.13 |
| TPSA | 187.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.68 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|