C11H12Cl2N3O4P — CID 135133666
1-[aziridin-1-yl-[(2,6-dichloro-4-nitrophenyl)methoxy]phosphoryl]aziridine (PubChem CID 135133666) has the molecular formula C11H12Cl2N3O4P and a molecular weight of 352.11 g/mol. Its IUPAC name is 1-[aziridin-1-yl-[(2,6-dichloro-4-nitrophenyl)methoxy]phosphoryl]aziridine.
| Compound Name | 1-[aziridin-1-yl-[(2,6-dichloro-4-nitrophenyl)methoxy]phosphoryl]aziridine |
|---|---|
| PubChem CID | 135133666 |
| Molecular Formula | C11H12Cl2N3O4P |
| Molecular Weight | 352.11 g/mol |
| Exact Mass | 350.99 |
| IUPAC Name | 1-[aziridin-1-yl-[(2,6-dichloro-4-nitrophenyl)methoxy]phosphoryl]aziridine |
| SMILES | O=[N+]([O-])c1cc(Cl)c(COP(=O)(N2CC2)N2CC2)c(Cl)c1 |
| InChI | InChI=1S/C11H12Cl2N3O4P/c12-10-5-8(16(17)18)6-11(13)9(10)7-20-21(19,14-1-2-14)15-3-4-15/h5-6H,1-4,7H2 |
| InChIKey | DAIQTARMWFNYOV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 75.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.11 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|