C15H13Cl4NO4 — CID 88758720
cis-(2,6-dichloro-4-nitrophenyl)methyl (1S,3R)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 88758720) has the molecular formula C15H13Cl4NO4 and a molecular weight of 413.08 g/mol. Its IUPAC name is cis-(2,6-dichloro-4-nitrophenyl)methyl (1S,3R)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | cis-(2,6-dichloro-4-nitrophenyl)methyl (1S,3R)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 88758720 |
| Molecular Formula | C15H13Cl4NO4 |
| Molecular Weight | 413.08 g/mol |
| Exact Mass | 410.96 |
| IUPAC Name | cis-(2,6-dichloro-4-nitrophenyl)methyl (1S,3R)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CC1(C)[C@@H](C=C(Cl)Cl)[C@@H]1C(=O)OCc1c(Cl)cc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C15H13Cl4NO4/c1-15(2)9(5-12(18)19)13(15)14(21)24-6-8-10(16)3-7(20(22)23)4-11(8)17/h3-5,9,13H,6H2,1-2H3/t9-,13+/m0/s1 |
| InChIKey | AUQDRMZVZKZQTJ-TVQRCGJNSA-N |
| XLogP | 5.54 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.08 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|