C18H14N4O13PS2- — CID 137003119
3-[[4-formyl-5-hydroxy-6-methyl-3-(phosphonooxymethyl)-2-pyridinyl]diazenyl]-7-nitro-5-sulfonaphthalene-1-sulfinate (PubChem CID 137003119) has the molecular formula C18H14N4O13PS2- and a molecular weight of 589.43 g/mol. Its IUPAC name is 3-[[4-formyl-5-hydroxy-6-methyl-3-(phosphonooxymethyl)-2-pyridinyl]diazenyl]-7-nitro-5-sulfonaphthalene-1-sulfinate.
| Compound Name | 3-[[4-formyl-5-hydroxy-6-methyl-3-(phosphonooxymethyl)-2-pyridinyl]diazenyl]-7-nitro-5-sulfonaphthalene-1-sulfinate |
|---|---|
| PubChem CID | 137003119 |
| Molecular Formula | C18H14N4O13PS2- |
| Molecular Weight | 589.43 g/mol |
| Exact Mass | 588.97 |
| IUPAC Name | 3-[[4-formyl-5-hydroxy-6-methyl-3-(phosphonooxymethyl)-2-pyridinyl]diazenyl]-7-nitro-5-sulfonaphthalene-1-sulfinate |
| SMILES | Cc1nc(/N=N/c2cc(S(=O)[O-])c3cc([N+](=O)[O-])cc(S(=O)(=O)O)c3c2)c(COP(=O)(O)O)c(C=O)c1O |
| InChI | InChI=1S/C18H15N4O13PS2/c1-8-17(24)13(6-23)14(7-35-36(27,28)29)18(19-8)21-20-9-2-12-11(15(3-9)37(30)31)4-10(22(25)26)5-16(12)38(32,33)34/h2-6,24H,7H2,1H3,(H,30,31)(H2,27,28,29)(H,32,33,34)/p-1/b21-20+ |
| InChIKey | NXNMBWUNSPMUQC-QZQOTICOSA-M |
| XLogP | 2.48 |
| TPSA | 279.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.43 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|