C15H16N3O11PS2 — CID 177375416
4-[[4-formyl-5,6-dimethyl-3-(phosphonooxymethyl)-2-pyridinyl]diazenyl]benzene-1,3-disulfonic acid (PubChem CID 177375416) has the molecular formula C15H16N3O11PS2 and a molecular weight of 509.41 g/mol. Its IUPAC name is 4-[[4-formyl-5,6-dimethyl-3-(phosphonooxymethyl)-2-pyridinyl]diazenyl]benzene-1,3-disulfonic acid.
| Compound Name | 4-[[4-formyl-5,6-dimethyl-3-(phosphonooxymethyl)-2-pyridinyl]diazenyl]benzene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 177375416 |
| Molecular Formula | C15H16N3O11PS2 |
| Molecular Weight | 509.41 g/mol |
| Exact Mass | 509.00 |
| IUPAC Name | 4-[[4-formyl-5,6-dimethyl-3-(phosphonooxymethyl)-2-pyridinyl]diazenyl]benzene-1,3-disulfonic acid |
| SMILES | Cc1nc(/N=N/c2ccc(S(=O)(=O)O)cc2S(=O)(=O)O)c(COP(=O)(O)O)c(C=O)c1C |
| InChI | InChI=1S/C15H16N3O11PS2/c1-8-9(2)16-15(12(11(8)6-19)7-29-30(20,21)22)18-17-13-4-3-10(31(23,24)25)5-14(13)32(26,27)28/h3-6H,7H2,1-2H3,(H2,20,21,22)(H,23,24,25)(H,26,27,28)/b18-17+ |
| InChIKey | ZCFMMINHJVICPU-ISLYRVAYSA-N |
| XLogP | 2.03 |
| TPSA | 230.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.41 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|