C30H24N2O2S2 — CID 146021203
15-methyl-9,12-diphenyl-11,14λ6-dithia-9,15-diazapentacyclo[11.8.0.02,10.03,8.016,21]henicosa-2(10),3,5,7,16,18,20-heptaene 14,14-dioxide (PubChem CID 146021203) has the molecular formula C30H24N2O2S2 and a molecular weight of 508.67 g/mol. Its IUPAC name is 15-methyl-9,12-diphenyl-11,14λ6-dithia-9,15-diazapentacyclo[11.8.0.02,10.03,8.016,21]henicosa-2(10),3,5,7,16,18,20-heptaene 14,14-dioxide.
| Compound Name | 15-methyl-9,12-diphenyl-11,14λ6-dithia-9,15-diazapentacyclo[11.8.0.02,10.03,8.016,21]henicosa-2(10),3,5,7,16,18,20-heptaene 14,14-dioxide |
|---|---|
| PubChem CID | 146021203 |
| Molecular Formula | C30H24N2O2S2 |
| Molecular Weight | 508.67 g/mol |
| Exact Mass | 508.13 |
| IUPAC Name | 15-methyl-9,12-diphenyl-11,14λ6-dithia-9,15-diazapentacyclo[11.8.0.02,10.03,8.016,21]henicosa-2(10),3,5,7,16,18,20-heptaene 14,14-dioxide |
| SMILES | CN1c2ccccc2C2c3c(n(-c4ccccc4)c4ccccc34)SC(c3ccccc3)C2S1(=O)=O |
| InChI | InChI=1S/C30H24N2O2S2/c1-31-24-18-10-8-16-22(24)26-27-23-17-9-11-19-25(23)32(21-14-6-3-7-15-21)30(27)35-28(29(26)36(31,33)34)20-12-4-2-5-13-20/h2-19,26,28-29H,1H3 |
| InChIKey | MQFPNVDNUTYUTJ-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.67 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |