C15H9N5O3S2 — CID 146023374
(4E)-4-[hydroxy(pyrazin-2-yl)methylidene]-1-(1,3,4-thiadiazol-2-yl)-5-thiophen-3-ylpyrrolidine-2,3-dione (PubChem CID 146023374) has the molecular formula C15H9N5O3S2 and a molecular weight of 371.40 g/mol. Its IUPAC name is (4E)-4-[hydroxy(pyrazin-2-yl)methylidene]-1-(1,3,4-thiadiazol-2-yl)-5-thiophen-3-ylpyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[hydroxy(pyrazin-2-yl)methylidene]-1-(1,3,4-thiadiazol-2-yl)-5-thiophen-3-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 146023374 |
| Molecular Formula | C15H9N5O3S2 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | (4E)-4-[hydroxy(pyrazin-2-yl)methylidene]-1-(1,3,4-thiadiazol-2-yl)-5-thiophen-3-ylpyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2nncs2)C(c2ccsc2)/C1=C(\O)c1cnccn1 |
| InChI | InChI=1S/C15H9N5O3S2/c21-12(9-5-16-2-3-17-9)10-11(8-1-4-24-6-8)20(14(23)13(10)22)15-19-18-7-25-15/h1-7,11,21H/b12-10+ |
| InChIKey | LJRZIDYDACPICV-ZRDIBKRKSA-N |
| XLogP | 2.02 |
| TPSA | 109.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|