C24H17BrFNO5S — CID 146023580
(4E)-5-(5-bromo-2-fluorophenyl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(thiophen-2-ylmethyl)pyrrolidine-2,3-dione (PubChem CID 146023580) has the molecular formula C24H17BrFNO5S and a molecular weight of 530.37 g/mol. Its IUPAC name is (4E)-5-(5-bromo-2-fluorophenyl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(thiophen-2-ylmethyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-5-(5-bromo-2-fluorophenyl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(thiophen-2-ylmethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 146023580 |
| Molecular Formula | C24H17BrFNO5S |
| Molecular Weight | 530.37 g/mol |
| Exact Mass | 529.00 |
| IUPAC Name | (4E)-5-(5-bromo-2-fluorophenyl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(thiophen-2-ylmethyl)pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(Cc2cccs2)C(c2cc(Br)ccc2F)/C1=C(\O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C24H17BrFNO5S/c25-14-4-5-17(26)16(11-14)21-20(23(29)24(30)27(21)12-15-2-1-9-33-15)22(28)13-3-6-18-19(10-13)32-8-7-31-18/h1-6,9-11,21,28H,7-8,12H2/b22-20+ |
| InChIKey | IQQXQBDVOSLJHP-LSDHQDQOSA-N |
| XLogP | 5.04 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.37 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|