C20H21N3O6S — CID 146023965
(4E)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-[hydroxy-(3-methoxy-4-methylphenyl)methylidene]-1-(1,3,4-thiadiazol-2-yl)pyrrolidine-2,3-dione (PubChem CID 146023965) has the molecular formula C20H21N3O6S and a molecular weight of 431.47 g/mol. Its IUPAC name is (4E)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-[hydroxy-(3-methoxy-4-methylphenyl)methylidene]-1-(1,3,4-thiadiazol-2-yl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-[hydroxy-(3-methoxy-4-methylphenyl)methylidene]-1-(1,3,4-thiadiazol-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 146023965 |
| Molecular Formula | C20H21N3O6S |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | (4E)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-[hydroxy-(3-methoxy-4-methylphenyl)methylidene]-1-(1,3,4-thiadiazol-2-yl)pyrrolidine-2,3-dione |
| SMILES | COc1cc(/C(O)=C2\C(=O)C(=O)N(c3nncs3)C2C2COC(C)(C)O2)ccc1C |
| InChI | InChI=1S/C20H21N3O6S/c1-10-5-6-11(7-12(10)27-4)16(24)14-15(13-8-28-20(2,3)29-13)23(18(26)17(14)25)19-22-21-9-30-19/h5-7,9,13,15,24H,8H2,1-4H3/b16-14+ |
| InChIKey | PZXRIFPDEHOVIB-JQIJEIRASA-N |
| XLogP | 2.26 |
| TPSA | 111.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|