C9H11NO4 — CID 14602555
5-(3,4-dihydroxyoxolan-2-yl)-1H-pyrrole-3-carbaldehyde (PubChem CID 14602555) has the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. Its IUPAC name is 5-(3,4-dihydroxyoxolan-2-yl)-1H-pyrrole-3-carbaldehyde.
| Compound Name | 5-(3,4-dihydroxyoxolan-2-yl)-1H-pyrrole-3-carbaldehyde |
|---|---|
| PubChem CID | 14602555 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 5-(3,4-dihydroxyoxolan-2-yl)-1H-pyrrole-3-carbaldehyde |
| SMILES | O=Cc1c[nH]c(C2OCC(O)C2O)c1 |
| InChI | InChI=1S/C9H11NO4/c11-3-5-1-6(10-2-5)9-8(13)7(12)4-14-9/h1-3,7-10,12-13H,4H2 |
| InChIKey | ROBHWCTVPCDPLJ-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|