About 7-[3-(aminomethyl)-4-(1,3-thiazol-4-ylmethoxy)phenyl]-4-methylquinolin-2-amine
7-[3-(aminomethyl)-4-(1,3-thiazol-4-ylmethoxy)phenyl]-4-methylquinolin-2-amine (PubChem CID 146025978) has the molecular formula C21H20N4OS
and a molecular weight of 376.49 g/mol. Its IUPAC name is 7-[3-(aminomethyl)-4-(1,3-thiazol-4-ylmethoxy)phenyl]-4-methylquinolin-2-amine.
Molecular Properties
| Compound Name | 7-[3-(aminomethyl)-4-(1,3-thiazol-4-ylmethoxy)phenyl]-4-methylquinolin-2-amine |
| PubChem CID | 146025978 |
| Molecular Formula | C21H20N4OS |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 7-[3-(aminomethyl)-4-(1,3-thiazol-4-ylmethoxy)phenyl]-4-methylquinolin-2-amine |
| SMILES | Cc1cc(N)nc2cc(-c3ccc(OCc4cscn4)c(CN)c3)ccc12 |
| InChI | InChI=1S/C21H20N4OS/c1-13-6-21(23)25-19-8-15(2-4-18(13)19)14-3-5-20(16(7-14)9-22)26-10-17-11-27-12-24-17/h2-8,11-12H,9-10,22H2,1H3,(H2,23,25) |
| InChIKey | QMLWVSKDYLAYRJ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-[3-(aminomethyl)-4-(1,3-thiazol-4-ylmethoxy)phenyl]-4-methylquinolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[3-(aminomethyl)-4-(1,3-thiazol-4-ylmethoxy)phenyl]-4-methylquinolin-2-amine?
The IUPAC name of 7-[3-(aminomethyl)-4-(1,3-thiazol-4-ylmethoxy)phenyl]-4-methylquinolin-2-amine (CID 146025978) is 7-[3-(aminomethyl)-4-(1,3-thiazol-4-ylmethoxy)phenyl]-4-methylquinolin-2-amine.
What is the SMILES notation for 7-[3-(aminomethyl)-4-(1,3-thiazol-4-ylmethoxy)phenyl]-4-methylquinolin-2-amine?
The canonical SMILES for 7-[3-(aminomethyl)-4-(1,3-thiazol-4-ylmethoxy)phenyl]-4-methylquinolin-2-amine is Cc1cc(N)nc2cc(-c3ccc(OCc4cscn4)c(CN)c3)ccc12.
What is the InChIKey of 7-[3-(aminomethyl)-4-(1,3-thiazol-4-ylmethoxy)phenyl]-4-methylquinolin-2-amine?
The InChIKey is QMLWVSKDYLAYRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N4OS/c1-13-6-21(23)25-19-8-15(2-4-18(13)19)14-3-5-20(16(7-14)9-22)26-10-17-11-27-12-24-17/h2-8,11-12H,9-10,22H2,1H3,(H2,23,25).
What are the key properties of 7-[3-(aminomethyl)-4-(1,3-thiazol-4-ylmethoxy)phenyl]-4-methylquinolin-2-amine?
7-[3-(aminomethyl)-4-(1,3-thiazol-4-ylmethoxy)phenyl]-4-methylquinolin-2-amine has a molecular weight of 376.49 g/mol, XLogP of 4.29, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[3-(aminomethyl)-4-(1,3-thiazol-4-ylmethoxy)phenyl]-4-methylquinolin-2-amine is sourced from PubChem (CID 146025978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).