C17H21N3OS — CID 146028411
(2E)-2-[(E)-(2,3-dimethyl-6,7,8,9-tetrahydrobenzo[7]annulen-5-ylidene)hydrazinylidene]-1,3-thiazinan-4-one (PubChem CID 146028411) has the molecular formula C17H21N3OS and a molecular weight of 315.44 g/mol. Its IUPAC name is (2E)-2-[(E)-(2,3-dimethyl-6,7,8,9-tetrahydrobenzo[7]annulen-5-ylidene)hydrazinylidene]-1,3-thiazinan-4-one.
| Compound Name | (2E)-2-[(E)-(2,3-dimethyl-6,7,8,9-tetrahydrobenzo[7]annulen-5-ylidene)hydrazinylidene]-1,3-thiazinan-4-one |
|---|---|
| PubChem CID | 146028411 |
| Molecular Formula | C17H21N3OS |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | (2E)-2-[(E)-(2,3-dimethyl-6,7,8,9-tetrahydrobenzo[7]annulen-5-ylidene)hydrazinylidene]-1,3-thiazinan-4-one |
| SMILES | Cc1cc2c(cc1C)/C(=N/N=C1\NC(=O)CCS1)CCCC2 |
| InChI | InChI=1S/C17H21N3OS/c1-11-9-13-5-3-4-6-15(14(13)10-12(11)2)19-20-17-18-16(21)7-8-22-17/h9-10H,3-8H2,1-2H3,(H,18,20,21)/b19-15+ |
| InChIKey | NBYCJSVYWDXRBS-XDJHFCHBSA-N |
| XLogP | 3.34 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|