C13H11NO4P+ — CID 146033536
(2R)-2-(6-methoxy-2-pyridinyl)-3-oxo-2H-1,3-benzoxaphosphol-3-ium-4-ol (PubChem CID 146033536) has the molecular formula C13H11NO4P+ and a molecular weight of 276.21 g/mol. Its IUPAC name is (2R)-2-(6-methoxy-2-pyridinyl)-3-oxo-2H-1,3-benzoxaphosphol-3-ium-4-ol.
| Compound Name | (2R)-2-(6-methoxy-2-pyridinyl)-3-oxo-2H-1,3-benzoxaphosphol-3-ium-4-ol |
|---|---|
| PubChem CID | 146033536 |
| Molecular Formula | C13H11NO4P+ |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | (2R)-2-(6-methoxy-2-pyridinyl)-3-oxo-2H-1,3-benzoxaphosphol-3-ium-4-ol |
| SMILES | COc1cccc([C@@H]2Oc3cccc(O)c3[P+]2=O)n1 |
| InChI | InChI=1S/C13H10NO4P/c1-17-11-7-2-4-8(14-11)13-18-10-6-3-5-9(15)12(10)19(13)16/h2-7,13H,1H3/p+1/t13-/m1/s1 |
| InChIKey | FOAAMZVAMUTBPZ-CYBMUJFWSA-O |
| XLogP | 2.34 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|