C11H11NO3 — CID 103348635
2-(6-methoxy-2-pyridinyl)-2,3-dihydropyran-4-one (PubChem CID 103348635) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is 2-(6-methoxy-2-pyridinyl)-2,3-dihydropyran-4-one.
| Compound Name | 2-(6-methoxy-2-pyridinyl)-2,3-dihydropyran-4-one |
|---|---|
| PubChem CID | 103348635 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 2-(6-methoxy-2-pyridinyl)-2,3-dihydropyran-4-one |
| SMILES | COc1cccc(C2CC(=O)C=CO2)n1 |
| InChI | InChI=1S/C11H11NO3/c1-14-11-4-2-3-9(12-11)10-7-8(13)5-6-15-10/h2-6,10H,7H2,1H3 |
| InChIKey | LDRSIJYHRRLGDW-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |