C30H38N2O4 — CID 146036654
4-benzyl-N,1-dicyclohexyl-2,4-dihydroxy-5-oxo-3-phenylpyrrolidine-2-carboxamide (PubChem CID 146036654) has the molecular formula C30H38N2O4 and a molecular weight of 490.64 g/mol. Its IUPAC name is 4-benzyl-N,1-dicyclohexyl-2,4-dihydroxy-5-oxo-3-phenylpyrrolidine-2-carboxamide.
| Compound Name | 4-benzyl-N,1-dicyclohexyl-2,4-dihydroxy-5-oxo-3-phenylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 146036654 |
| Molecular Formula | C30H38N2O4 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.28 |
| IUPAC Name | 4-benzyl-N,1-dicyclohexyl-2,4-dihydroxy-5-oxo-3-phenylpyrrolidine-2-carboxamide |
| SMILES | O=C1N(C2CCCCC2)C(O)(C(=O)NC2CCCCC2)C(c2ccccc2)C1(O)Cc1ccccc1 |
| InChI | InChI=1S/C30H38N2O4/c33-27(31-24-17-9-3-10-18-24)30(36)26(23-15-7-2-8-16-23)29(35,21-22-13-5-1-6-14-22)28(34)32(30)25-19-11-4-12-20-25/h1-2,5-8,13-16,24-26,35-36H,3-4,9-12,17-21H2,(H,31,33) |
| InChIKey | AHNUAAZKCPWMEG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |