C17H21N5O3S — CID 1460446
N'-[2-[(5-cyclopropyl-4-ethyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-4-methoxybenzohydrazide (PubChem CID 1460446) has the molecular formula C17H21N5O3S and a molecular weight of 375.45 g/mol. Its IUPAC name is N'-[2-[(5-cyclopropyl-4-ethyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-4-methoxybenzohydrazide.
| Compound Name | N'-[2-[(5-cyclopropyl-4-ethyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-4-methoxybenzohydrazide |
|---|---|
| PubChem CID | 1460446 |
| Molecular Formula | C17H21N5O3S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | N'-[2-[(5-cyclopropyl-4-ethyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-4-methoxybenzohydrazide |
| SMILES | CCn1c(SCC(=O)NNC(=O)c2ccc(OC)cc2)nnc1C1CC1 |
| InChI | InChI=1S/C17H21N5O3S/c1-3-22-15(11-4-5-11)19-21-17(22)26-10-14(23)18-20-16(24)12-6-8-13(25-2)9-7-12/h6-9,11H,3-5,10H2,1-2H3,(H,18,23)(H,20,24) |
| InChIKey | PWUNCKJBAKAGKO-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|