C21H22N8O2 — CID 146047288
6-[[4-(3-cyano-2-methoxyanilino)-2-methyl-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-6-yl]amino]pyridine-3-carbonitrile (PubChem CID 146047288) has the molecular formula C21H22N8O2 and a molecular weight of 418.46 g/mol. Its IUPAC name is 6-[[4-(3-cyano-2-methoxyanilino)-2-methyl-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-6-yl]amino]pyridine-3-carbonitrile.
| Compound Name | 6-[[4-(3-cyano-2-methoxyanilino)-2-methyl-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-6-yl]amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 146047288 |
| Molecular Formula | C21H22N8O2 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 6-[[4-(3-cyano-2-methoxyanilino)-2-methyl-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-6-yl]amino]pyridine-3-carbonitrile |
| SMILES | COc1c(C#N)cccc1NC1CC(Nc2ccc(C#N)cn2)NC2NN(C)C(=O)C12 |
| InChI | InChI=1S/C21H22N8O2/c1-29-21(30)18-15(25-14-5-3-4-13(10-23)19(14)31-2)8-17(27-20(18)28-29)26-16-7-6-12(9-22)11-24-16/h3-7,11,15,17-18,20,25,27-28H,8H2,1-2H3,(H,24,26) |
| InChIKey | YKVRURROGQZUGK-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 138.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |