C21H25ClN8O2 — CID 146047393
6-[[4-(3-chloro-2-methoxyanilino)-2-methyl-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-6-yl]amino]-3-ethylpyrazine-2-carbonitrile (PubChem CID 146047393) has the molecular formula C21H25ClN8O2 and a molecular weight of 456.94 g/mol. Its IUPAC name is 6-[[4-(3-chloro-2-methoxyanilino)-2-methyl-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-6-yl]amino]-3-ethylpyrazine-2-carbonitrile.
| Compound Name | 6-[[4-(3-chloro-2-methoxyanilino)-2-methyl-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-6-yl]amino]-3-ethylpyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 146047393 |
| Molecular Formula | C21H25ClN8O2 |
| Molecular Weight | 456.94 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 6-[[4-(3-chloro-2-methoxyanilino)-2-methyl-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-6-yl]amino]-3-ethylpyrazine-2-carbonitrile |
| SMILES | CCc1ncc(NC2CC(Nc3cccc(Cl)c3OC)C3C(=O)N(C)NC3N2)nc1C#N |
| InChI | InChI=1S/C21H25ClN8O2/c1-4-12-15(9-23)26-17(10-24-12)27-16-8-14(18-20(28-16)29-30(2)21(18)31)25-13-7-5-6-11(22)19(13)32-3/h5-7,10,14,16,18,20,25,28-29H,4,8H2,1-3H3,(H,26,27) |
| InChIKey | QEBSRHHJPWKKNP-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 127.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.94 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |