C24H29N7O2S — CID 146047294
4-[2-methoxy-3-(5-methyl-1,3-thiazol-2-yl)anilino]-2-methyl-6-[(4-methyl-2-pyridinyl)amino]-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one (PubChem CID 146047294) has the molecular formula C24H29N7O2S and a molecular weight of 479.61 g/mol. Its IUPAC name is 4-[2-methoxy-3-(5-methyl-1,3-thiazol-2-yl)anilino]-2-methyl-6-[(4-methyl-2-pyridinyl)amino]-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one.
| Compound Name | 4-[2-methoxy-3-(5-methyl-1,3-thiazol-2-yl)anilino]-2-methyl-6-[(4-methyl-2-pyridinyl)amino]-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one |
|---|---|
| PubChem CID | 146047294 |
| Molecular Formula | C24H29N7O2S |
| Molecular Weight | 479.61 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | 4-[2-methoxy-3-(5-methyl-1,3-thiazol-2-yl)anilino]-2-methyl-6-[(4-methyl-2-pyridinyl)amino]-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one |
| SMILES | COc1c(NC2CC(Nc3cc(C)ccn3)NC3NN(C)C(=O)C23)cccc1-c1ncc(C)s1 |
| InChI | InChI=1S/C24H29N7O2S/c1-13-8-9-25-18(10-13)28-19-11-17(20-22(29-19)30-31(3)24(20)32)27-16-7-5-6-15(21(16)33-4)23-26-12-14(2)34-23/h5-10,12,17,19-20,22,27,29-30H,11H2,1-4H3,(H,25,28) |
| InChIKey | FMDBTYDWQARQDB-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 103.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.61 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |