C22H25N11O2 — CID 166596254
6-[(5-isocyano-2-pyridinyl)amino]-4-[2-methoxy-3-(2-methyltetrazol-5-yl)anilino]-2-methyl-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one (PubChem CID 166596254) has the molecular formula C22H25N11O2 and a molecular weight of 475.52 g/mol. Its IUPAC name is 6-[(5-isocyano-2-pyridinyl)amino]-4-[2-methoxy-3-(2-methyltetrazol-5-yl)anilino]-2-methyl-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one.
| Compound Name | 6-[(5-isocyano-2-pyridinyl)amino]-4-[2-methoxy-3-(2-methyltetrazol-5-yl)anilino]-2-methyl-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one |
|---|---|
| PubChem CID | 166596254 |
| Molecular Formula | C22H25N11O2 |
| Molecular Weight | 475.52 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | 6-[(5-isocyano-2-pyridinyl)amino]-4-[2-methoxy-3-(2-methyltetrazol-5-yl)anilino]-2-methyl-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one |
| SMILES | [C-]#[N+]c1ccc(NC2CC(Nc3cccc(-c4nnn(C)n4)c3OC)C3C(=O)N(C)NC3N2)nc1 |
| InChI | InChI=1S/C22H25N11O2/c1-23-12-8-9-16(24-11-12)26-17-10-15(18-21(27-17)29-32(2)22(18)34)25-14-7-5-6-13(19(14)35-4)20-28-31-33(3)30-20/h5-9,11,15,17-18,21,25,27,29H,10H2,2-4H3,(H,24,26) |
| InChIKey | AVOPJKQOSTVYJF-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 138.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.52 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|