C22H27FN6O2 — CID 146047338
6-[(5-cyclopropyl-2-pyridinyl)amino]-4-(3-fluoro-2-methoxyanilino)-2-methyl-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one (PubChem CID 146047338) has the molecular formula C22H27FN6O2 and a molecular weight of 426.50 g/mol. Its IUPAC name is 6-[(5-cyclopropyl-2-pyridinyl)amino]-4-(3-fluoro-2-methoxyanilino)-2-methyl-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one.
| Compound Name | 6-[(5-cyclopropyl-2-pyridinyl)amino]-4-(3-fluoro-2-methoxyanilino)-2-methyl-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one |
|---|---|
| PubChem CID | 146047338 |
| Molecular Formula | C22H27FN6O2 |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 6-[(5-cyclopropyl-2-pyridinyl)amino]-4-(3-fluoro-2-methoxyanilino)-2-methyl-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one |
| SMILES | COc1c(F)cccc1NC1CC(Nc2ccc(C3CC3)cn2)NC2NN(C)C(=O)C12 |
| InChI | InChI=1S/C22H27FN6O2/c1-29-22(30)19-16(25-15-5-3-4-14(23)20(15)31-2)10-18(27-21(19)28-29)26-17-9-8-13(11-24-17)12-6-7-12/h3-5,8-9,11-12,16,18-19,21,25,27-28H,6-7,10H2,1-2H3,(H,24,26) |
| InChIKey | RMKKQGZOQXBKRR-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |