C23H30F2N6O4 — CID 146047396
N-[4-[2-(difluoromethoxy)-4-(pyrrolidine-1-carbonyl)anilino]-2-methyl-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-6-yl]cyclopropanecarboxamide (PubChem CID 146047396) has the molecular formula C23H30F2N6O4 and a molecular weight of 492.53 g/mol. Its IUPAC name is N-[4-[2-(difluoromethoxy)-4-(pyrrolidine-1-carbonyl)anilino]-2-methyl-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-6-yl]cyclopropanecarboxamide.
| Compound Name | N-[4-[2-(difluoromethoxy)-4-(pyrrolidine-1-carbonyl)anilino]-2-methyl-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-6-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 146047396 |
| Molecular Formula | C23H30F2N6O4 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | N-[4-[2-(difluoromethoxy)-4-(pyrrolidine-1-carbonyl)anilino]-2-methyl-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-6-yl]cyclopropanecarboxamide |
| SMILES | CN1NC2NC(NC(=O)C3CC3)CC(Nc3ccc(C(=O)N4CCCC4)cc3OC(F)F)C2C1=O |
| InChI | InChI=1S/C23H30F2N6O4/c1-30-22(34)18-15(11-17(27-19(18)29-30)28-20(32)12-4-5-12)26-14-7-6-13(10-16(14)35-23(24)25)21(33)31-8-2-3-9-31/h6-7,10,12,15,17-19,23,26-27,29H,2-5,8-9,11H2,1H3,(H,28,32) |
| InChIKey | DCDQEDOAIGJBBZ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |