C22H22BF2NO5 — CID 146047972
6-(difluoromethoxy)-2-[2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-benzoxazole-5-carbaldehyde (PubChem CID 146047972) has the molecular formula C22H22BF2NO5 and a molecular weight of 429.23 g/mol. Its IUPAC name is 6-(difluoromethoxy)-2-[2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-benzoxazole-5-carbaldehyde.
| Compound Name | 6-(difluoromethoxy)-2-[2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-benzoxazole-5-carbaldehyde |
|---|---|
| PubChem CID | 146047972 |
| Molecular Formula | C22H22BF2NO5 |
| Molecular Weight | 429.23 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 6-(difluoromethoxy)-2-[2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-benzoxazole-5-carbaldehyde |
| SMILES | Cc1c(B2OC(C)(C)C(C)(C)O2)cccc1-c1nc2cc(C=O)c(OC(F)F)cc2o1 |
| InChI | InChI=1S/C22H22BF2NO5/c1-12-14(7-6-8-15(12)23-30-21(2,3)22(4,5)31-23)19-26-16-9-13(11-27)17(29-20(24)25)10-18(16)28-19/h6-11,20H,1-5H3 |
| InChIKey | WDUOYBSALJCQKG-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.23 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|