C24H23NO6 — CID 146048709
N-(2-hydroxyethyl)-2-[2-(4-methoxyphenyl)-4,9-dimethyl-7-oxofuro[2,3-f]chromen-3-yl]acetamide (PubChem CID 146048709) has the molecular formula C24H23NO6 and a molecular weight of 421.45 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-2-[2-(4-methoxyphenyl)-4,9-dimethyl-7-oxofuro[2,3-f]chromen-3-yl]acetamide.
| Compound Name | N-(2-hydroxyethyl)-2-[2-(4-methoxyphenyl)-4,9-dimethyl-7-oxofuro[2,3-f]chromen-3-yl]acetamide |
|---|---|
| PubChem CID | 146048709 |
| Molecular Formula | C24H23NO6 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | N-(2-hydroxyethyl)-2-[2-(4-methoxyphenyl)-4,9-dimethyl-7-oxofuro[2,3-f]chromen-3-yl]acetamide |
| SMILES | COc1ccc(-c2oc3c(c(C)cc4oc(=O)cc(C)c43)c2CC(=O)NCCO)cc1 |
| InChI | InChI=1S/C24H23NO6/c1-13-10-18-22(14(2)11-20(28)30-18)24-21(13)17(12-19(27)25-8-9-26)23(31-24)15-4-6-16(29-3)7-5-15/h4-7,10-11,26H,8-9,12H2,1-3H3,(H,25,27) |
| InChIKey | SYZOECAQDWJNAK-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|