C23H22N4O5 — CID 154925524
2-[2-(4-methoxyphenyl)-6-methyl-4-oxofuro[3,2-c]pyran-3-yl]-N-[2-(pyrimidin-2-ylamino)ethyl]acetamide (PubChem CID 154925524) has the molecular formula C23H22N4O5 and a molecular weight of 434.45 g/mol. Its IUPAC name is 2-[2-(4-methoxyphenyl)-6-methyl-4-oxofuro[3,2-c]pyran-3-yl]-N-[2-(pyrimidin-2-ylamino)ethyl]acetamide.
| Compound Name | 2-[2-(4-methoxyphenyl)-6-methyl-4-oxofuro[3,2-c]pyran-3-yl]-N-[2-(pyrimidin-2-ylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 154925524 |
| Molecular Formula | C23H22N4O5 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 2-[2-(4-methoxyphenyl)-6-methyl-4-oxofuro[3,2-c]pyran-3-yl]-N-[2-(pyrimidin-2-ylamino)ethyl]acetamide |
| SMILES | COc1ccc(-c2oc3cc(C)oc(=O)c3c2CC(=O)NCCNc2ncccn2)cc1 |
| InChI | InChI=1S/C23H22N4O5/c1-14-12-18-20(22(29)31-14)17(21(32-18)15-4-6-16(30-2)7-5-15)13-19(28)24-10-11-27-23-25-8-3-9-26-23/h3-9,12H,10-11,13H2,1-2H3,(H,24,28)(H,25,26,27) |
| InChIKey | AASCLRAUSYTFME-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|