C24H25IN2 — CID 146051220
(2E)-2-[(1-ethyl-5-methylpyridin-1-ium-2-yl)methylidene]-1,6-dimethylbenzo[h]quinoline iodide (PubChem CID 146051220) has the molecular formula C24H25IN2 and a molecular weight of 468.38 g/mol. Its IUPAC name is (2E)-2-[(1-ethyl-5-methylpyridin-1-ium-2-yl)methylidene]-1,6-dimethylbenzo[h]quinoline iodide.
| Compound Name | (2E)-2-[(1-ethyl-5-methylpyridin-1-ium-2-yl)methylidene]-1,6-dimethylbenzo[h]quinoline iodide |
|---|---|
| PubChem CID | 146051220 |
| Molecular Formula | C24H25IN2 |
| Molecular Weight | 468.38 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | (2E)-2-[(1-ethyl-5-methylpyridin-1-ium-2-yl)methylidene]-1,6-dimethylbenzo[h]quinoline iodide |
| SMILES | CC[n+]1cc(C)ccc1/C=C1\C=Cc2cc(C)c3ccccc3c2N1C.[I-] |
| InChI | InChI=1S/C24H25N2.HI/c1-5-26-16-17(2)10-12-21(26)15-20-13-11-19-14-18(3)22-8-6-7-9-23(22)24(19)25(20)4;/h6-16H,5H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | KPSAMFSXCRXCDI-UHFFFAOYSA-M |
| XLogP | 2.27 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|