C24H24FN2NaO4S — CID 146061374
sodium 2-[4-[(4-fluorophenyl)methyl-(4-propan-2-ylphenyl)sulfonylamino]phenyl]-N-oxidoacetamide (PubChem CID 146061374) has the molecular formula C24H24FN2NaO4S and a molecular weight of 478.52 g/mol. Its IUPAC name is sodium 2-[4-[(4-fluorophenyl)methyl-(4-propan-2-ylphenyl)sulfonylamino]phenyl]-N-oxidoacetamide.
| Compound Name | sodium 2-[4-[(4-fluorophenyl)methyl-(4-propan-2-ylphenyl)sulfonylamino]phenyl]-N-oxidoacetamide |
|---|---|
| PubChem CID | 146061374 |
| Molecular Formula | C24H24FN2NaO4S |
| Molecular Weight | 478.52 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | sodium 2-[4-[(4-fluorophenyl)methyl-(4-propan-2-ylphenyl)sulfonylamino]phenyl]-N-oxidoacetamide |
| SMILES | CC(C)c1ccc(S(=O)(=O)N(Cc2ccc(F)cc2)c2ccc(CC(=O)N[O-])cc2)cc1.[Na+] |
| InChI | InChI=1S/C24H24FN2O4S.Na/c1-17(2)20-7-13-23(14-8-20)32(30,31)27(16-19-3-9-21(25)10-4-19)22-11-5-18(6-12-22)15-24(28)26-29;/h3-14,17H,15-16H2,1-2H3,(H-,26,28,29);/q-1;+1 |
| InChIKey | QOCBKWGWIUBMGF-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.52 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|