C23H22FN2O4S- — CID 20967337
2-[4-[(2,5-dimethylphenyl)sulfonyl-[(4-fluorophenyl)methyl]amino]phenyl]-N-oxidoacetamide (PubChem CID 20967337) has the molecular formula C23H22FN2O4S- and a molecular weight of 441.50 g/mol. Its IUPAC name is 2-[4-[(2,5-dimethylphenyl)sulfonyl-[(4-fluorophenyl)methyl]amino]phenyl]-N-oxidoacetamide.
| Compound Name | 2-[4-[(2,5-dimethylphenyl)sulfonyl-[(4-fluorophenyl)methyl]amino]phenyl]-N-oxidoacetamide |
|---|---|
| PubChem CID | 20967337 |
| Molecular Formula | C23H22FN2O4S- |
| Molecular Weight | 441.50 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 2-[4-[(2,5-dimethylphenyl)sulfonyl-[(4-fluorophenyl)methyl]amino]phenyl]-N-oxidoacetamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N(Cc2ccc(F)cc2)c2ccc(CC(=O)N[O-])cc2)c1 |
| InChI | InChI=1S/C23H22FN2O4S/c1-16-3-4-17(2)22(13-16)31(29,30)26(15-19-5-9-20(24)10-6-19)21-11-7-18(8-12-21)14-23(27)25-28/h3-13H,14-15H2,1-2H3,(H-,25,27,28)/q-1 |
| InChIKey | RIRXITHOJSTCQU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.50 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|