C22H27N3O2 — CID 146066311
N-[(4-oxo-2-phenyl-3,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidin-7-yl)methyl]cyclopentanecarboxamide (PubChem CID 146066311) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is N-[(4-oxo-2-phenyl-3,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidin-7-yl)methyl]cyclopentanecarboxamide.
| Compound Name | N-[(4-oxo-2-phenyl-3,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidin-7-yl)methyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 146066311 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | N-[(4-oxo-2-phenyl-3,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidin-7-yl)methyl]cyclopentanecarboxamide |
| SMILES | O=C(NCC1CCc2nc(-c3ccccc3)[nH]c(=O)c2CC1)C1CCCC1 |
| InChI | InChI=1S/C22H27N3O2/c26-21(17-8-4-5-9-17)23-14-15-10-12-18-19(13-11-15)24-20(25-22(18)27)16-6-2-1-3-7-16/h1-3,6-7,15,17H,4-5,8-14H2,(H,23,26)(H,24,25,27) |
| InChIKey | GUYPRAJZGDPGKG-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |