C23H23FN4O2 — CID 146066370
N-[[2-(4-fluorophenyl)-4-oxo-3,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidin-7-yl]methyl]-6-methylpyridine-3-carboxamide (PubChem CID 146066370) has the molecular formula C23H23FN4O2 and a molecular weight of 406.46 g/mol. Its IUPAC name is N-[[2-(4-fluorophenyl)-4-oxo-3,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidin-7-yl]methyl]-6-methylpyridine-3-carboxamide.
| Compound Name | N-[[2-(4-fluorophenyl)-4-oxo-3,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidin-7-yl]methyl]-6-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 146066370 |
| Molecular Formula | C23H23FN4O2 |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | N-[[2-(4-fluorophenyl)-4-oxo-3,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidin-7-yl]methyl]-6-methylpyridine-3-carboxamide |
| SMILES | Cc1ccc(C(=O)NCC2CCc3nc(-c4ccc(F)cc4)[nH]c(=O)c3CC2)cn1 |
| InChI | InChI=1S/C23H23FN4O2/c1-14-2-5-17(13-25-14)22(29)26-12-15-3-10-19-20(11-4-15)27-21(28-23(19)30)16-6-8-18(24)9-7-16/h2,5-9,13,15H,3-4,10-12H2,1H3,(H,26,29)(H,27,28,30) |
| InChIKey | YUDCRKZIGFJXPF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |