C24H25N3O2 — CID 146068294
3-methyl-N-[(4-oxo-2-phenyl-3,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidin-7-yl)methyl]benzamide (PubChem CID 146068294) has the molecular formula C24H25N3O2 and a molecular weight of 387.48 g/mol. Its IUPAC name is 3-methyl-N-[(4-oxo-2-phenyl-3,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidin-7-yl)methyl]benzamide.
| Compound Name | 3-methyl-N-[(4-oxo-2-phenyl-3,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidin-7-yl)methyl]benzamide |
|---|---|
| PubChem CID | 146068294 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 3-methyl-N-[(4-oxo-2-phenyl-3,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidin-7-yl)methyl]benzamide |
| SMILES | Cc1cccc(C(=O)NCC2CCc3nc(-c4ccccc4)[nH]c(=O)c3CC2)c1 |
| InChI | InChI=1S/C24H25N3O2/c1-16-6-5-9-19(14-16)23(28)25-15-17-10-12-20-21(13-11-17)26-22(27-24(20)29)18-7-3-2-4-8-18/h2-9,14,17H,10-13,15H2,1H3,(H,25,28)(H,26,27,29) |
| InChIKey | VIXGKPVXQMOCDT-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |