C25H27N3O2 — CID 146066335
2,4-dimethyl-N-[(4-oxo-2-phenyl-3,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidin-7-yl)methyl]benzamide (PubChem CID 146066335) has the molecular formula C25H27N3O2 and a molecular weight of 401.51 g/mol. Its IUPAC name is 2,4-dimethyl-N-[(4-oxo-2-phenyl-3,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidin-7-yl)methyl]benzamide.
| Compound Name | 2,4-dimethyl-N-[(4-oxo-2-phenyl-3,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidin-7-yl)methyl]benzamide |
|---|---|
| PubChem CID | 146066335 |
| Molecular Formula | C25H27N3O2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | 2,4-dimethyl-N-[(4-oxo-2-phenyl-3,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidin-7-yl)methyl]benzamide |
| SMILES | Cc1ccc(C(=O)NCC2CCc3nc(-c4ccccc4)[nH]c(=O)c3CC2)c(C)c1 |
| InChI | InChI=1S/C25H27N3O2/c1-16-8-11-20(17(2)14-16)24(29)26-15-18-9-12-21-22(13-10-18)27-23(28-25(21)30)19-6-4-3-5-7-19/h3-8,11,14,18H,9-10,12-13,15H2,1-2H3,(H,26,29)(H,27,28,30) |
| InChIKey | CUKPUXUYACFEFJ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |