C20H30N2O5S — CID 146066890
10-(4-ethylphenyl)sulfonyl-6-(3-methoxypropyl)-2-oxa-6,10-diazaspiro[4.6]undecan-7-one (PubChem CID 146066890) has the molecular formula C20H30N2O5S and a molecular weight of 410.54 g/mol. Its IUPAC name is 10-(4-ethylphenyl)sulfonyl-6-(3-methoxypropyl)-2-oxa-6,10-diazaspiro[4.6]undecan-7-one.
| Compound Name | 10-(4-ethylphenyl)sulfonyl-6-(3-methoxypropyl)-2-oxa-6,10-diazaspiro[4.6]undecan-7-one |
|---|---|
| PubChem CID | 146066890 |
| Molecular Formula | C20H30N2O5S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | 10-(4-ethylphenyl)sulfonyl-6-(3-methoxypropyl)-2-oxa-6,10-diazaspiro[4.6]undecan-7-one |
| SMILES | CCc1ccc(S(=O)(=O)N2CCC(=O)N(CCCOC)C3(CCOC3)C2)cc1 |
| InChI | InChI=1S/C20H30N2O5S/c1-3-17-5-7-18(8-6-17)28(24,25)21-12-9-19(23)22(11-4-13-26-2)20(15-21)10-14-27-16-20/h5-8H,3-4,9-16H2,1-2H3 |
| InChIKey | OEWPUSOHHQTCDA-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|