C12H18O4S — CID 139894241
3-methoxypropyl 4-ethylbenzenesulfonate (PubChem CID 139894241) has the molecular formula C12H18O4S and a molecular weight of 258.34 g/mol. Its IUPAC name is 3-methoxypropyl 4-ethylbenzenesulfonate.
| Compound Name | 3-methoxypropyl 4-ethylbenzenesulfonate |
|---|---|
| PubChem CID | 139894241 |
| Molecular Formula | C12H18O4S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 3-methoxypropyl 4-ethylbenzenesulfonate |
| SMILES | CCc1ccc(S(=O)(=O)OCCCOC)cc1 |
| InChI | InChI=1S/C12H18O4S/c1-3-11-5-7-12(8-6-11)17(13,14)16-10-4-9-15-2/h5-8H,3-4,9-10H2,1-2H3 |
| InChIKey | AZHXLJHOIUCRMQ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|