C36H42O12S4 — CID 21102675
2,3,4-tris[(4-ethylphenyl)sulfonyloxy]butyl 4-ethylbenzenesulfonate (PubChem CID 21102675) has the molecular formula C36H42O12S4 and a molecular weight of 794.99 g/mol. Its IUPAC name is 2,3,4-tris[(4-ethylphenyl)sulfonyloxy]butyl 4-ethylbenzenesulfonate.
| Compound Name | 2,3,4-tris[(4-ethylphenyl)sulfonyloxy]butyl 4-ethylbenzenesulfonate |
|---|---|
| PubChem CID | 21102675 |
| Molecular Formula | C36H42O12S4 |
| Molecular Weight | 794.99 g/mol |
| Exact Mass | 794.16 |
| IUPAC Name | 2,3,4-tris[(4-ethylphenyl)sulfonyloxy]butyl 4-ethylbenzenesulfonate |
| SMILES | CCc1ccc(S(=O)(=O)OCC(OS(=O)(=O)c2ccc(CC)cc2)C(COS(=O)(=O)c2ccc(CC)cc2)OS(=O)(=O)c2ccc(CC)cc2)cc1 |
| InChI | InChI=1S/C36H42O12S4/c1-5-27-9-17-31(18-10-27)49(37,38)45-25-35(47-51(41,42)33-21-13-29(7-3)14-22-33)36(48-52(43,44)34-23-15-30(8-4)16-24-34)26-46-50(39,40)32-19-11-28(6-2)12-20-32/h9-24,35-36H,5-8,25-26H2,1-4H3 |
| InChIKey | QSFMPWWZAATBGO-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 173.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.99 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|