About triethylsilyl 4-ethylbenzenesulfonate
triethylsilyl 4-ethylbenzenesulfonate (PubChem CID 22104928) has the molecular formula C14H24O3SSi
and a molecular weight of 300.50 g/mol. Its IUPAC name is triethylsilyl 4-ethylbenzenesulfonate.
Molecular Properties
| Compound Name | triethylsilyl 4-ethylbenzenesulfonate |
| PubChem CID | 22104928 |
| Molecular Formula | C14H24O3SSi |
| Molecular Weight | 300.50 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | triethylsilyl 4-ethylbenzenesulfonate |
| SMILES | CCc1ccc(S(=O)(=O)O[Si](CC)(CC)CC)cc1 |
| InChI | InChI=1S/C14H24O3SSi/c1-5-13-9-11-14(12-10-13)18(15,16)17-19(6-2,7-3)8-4/h9-12H,5-8H2,1-4H3 |
| InChIKey | YTLOPZXFLJBTSL-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.50 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze triethylsilyl 4-ethylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethylsilyl 4-ethylbenzenesulfonate?
The IUPAC name of triethylsilyl 4-ethylbenzenesulfonate (CID 22104928) is triethylsilyl 4-ethylbenzenesulfonate.
What is the SMILES notation for triethylsilyl 4-ethylbenzenesulfonate?
The canonical SMILES for triethylsilyl 4-ethylbenzenesulfonate is CCc1ccc(S(=O)(=O)O[Si](CC)(CC)CC)cc1.
What is the InChIKey of triethylsilyl 4-ethylbenzenesulfonate?
The InChIKey is YTLOPZXFLJBTSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O3SSi/c1-5-13-9-11-14(12-10-13)18(15,16)17-19(6-2,7-3)8-4/h9-12H,5-8H2,1-4H3.
What are the key properties of triethylsilyl 4-ethylbenzenesulfonate?
triethylsilyl 4-ethylbenzenesulfonate has a molecular weight of 300.50 g/mol, XLogP of 3.96, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for triethylsilyl 4-ethylbenzenesulfonate is sourced from PubChem (CID 22104928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).