About 3-trimethylsilylpropyl 4-ethylbenzenesulfonate
3-trimethylsilylpropyl 4-ethylbenzenesulfonate (PubChem CID 21102850) has the molecular formula C14H24O3SSi
and a molecular weight of 300.50 g/mol. Its IUPAC name is 3-trimethylsilylpropyl 4-ethylbenzenesulfonate.
Molecular Properties
| Compound Name | 3-trimethylsilylpropyl 4-ethylbenzenesulfonate |
| PubChem CID | 21102850 |
| Molecular Formula | C14H24O3SSi |
| Molecular Weight | 300.50 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 3-trimethylsilylpropyl 4-ethylbenzenesulfonate |
| SMILES | CCc1ccc(S(=O)(=O)OCCC[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C14H24O3SSi/c1-5-13-7-9-14(10-8-13)18(15,16)17-11-6-12-19(2,3)4/h7-10H,5-6,11-12H2,1-4H3 |
| InChIKey | HWKIERIVGAKHAK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.50 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 3-trimethylsilylpropyl 4-ethylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-trimethylsilylpropyl 4-ethylbenzenesulfonate?
The IUPAC name of 3-trimethylsilylpropyl 4-ethylbenzenesulfonate (CID 21102850) is 3-trimethylsilylpropyl 4-ethylbenzenesulfonate.
What is the SMILES notation for 3-trimethylsilylpropyl 4-ethylbenzenesulfonate?
The canonical SMILES for 3-trimethylsilylpropyl 4-ethylbenzenesulfonate is CCc1ccc(S(=O)(=O)OCCC[Si](C)(C)C)cc1.
What is the InChIKey of 3-trimethylsilylpropyl 4-ethylbenzenesulfonate?
The InChIKey is HWKIERIVGAKHAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O3SSi/c1-5-13-7-9-14(10-8-13)18(15,16)17-11-6-12-19(2,3)4/h7-10H,5-6,11-12H2,1-4H3.
What are the key properties of 3-trimethylsilylpropyl 4-ethylbenzenesulfonate?
3-trimethylsilylpropyl 4-ethylbenzenesulfonate has a molecular weight of 300.50 g/mol, XLogP of 3.68, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-trimethylsilylpropyl 4-ethylbenzenesulfonate is sourced from PubChem (CID 21102850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).